CAS 1158781-57-7

1,3,4-Thiadiazole-2-acetic acid, 5-amino-, hydrochloride (1:1)

Description:

1,3,4-Thiadiazole-2-acetic acid, 5-amino-, hydrochloride (1:1) is a chemical compound characterized by its thiadiazole ring structure, which incorporates sulfur and nitrogen atoms, contributing to its unique properties. This compound features an acetic acid moiety, which enhances its solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the amino group at the 5-position of the thiadiazole ring suggests potential for biological activity, possibly influencing its interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in drug formulations. The compound's molecular structure allows for potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. Additionally, its specific CAS number, 1158781-57-7, allows for precise identification and sourcing in chemical databases and research contexts. Overall, this compound exemplifies the intersection of heterocyclic chemistry and medicinal applications.

Formula: C₄H₅N₃O₂S·ClH

InChI: InChI=1S/C4H5N3O2S.ClH/c5-4-7-6-2(10-4)1-3(8)9;/h1H2,(H2,5,7)(H,8,9);1H

InChI key: InChIKey=WHMMKSMJYCTHBR-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1SC(N)=NN1.Cl

Synonyms:

• 1,3,4-Thiadiazole-2-acetic acid, 5-amino-, hydrochloride (1:1)