
CAS 1158984-95-2
:(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][1-(phenylsulfonyl)-1H-indol-2-yl]boron
Description:
The chemical substance known as (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][1-(phenylsulfonyl)-1H-indol-2-yl]boron, with the CAS number 1158984-95-2, is a complex boron-containing compound that features a boron atom coordinated to a variety of functional groups. This compound is characterized by its unique structural elements, including a carboxymethyl group and a methylglycinate moiety, which contribute to its potential biological activity. The presence of the phenylsulfonyl group attached to an indole ring suggests that it may exhibit interesting pharmacological properties, possibly related to its interactions with biological targets. The coordination chemistry involving boron can also imply potential applications in medicinal chemistry, particularly in drug design and development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C19H17BN2O6S
InChI:InChI=1S/C19H17BN2O6S/c1-22-12-18(23)27-20(22,28-19(24)13-22)17-11-14-7-5-6-10-16(14)21(17)29(25,26)15-8-3-2-4-9-15/h2-11H,12-13H2,1H3
InChI key:InChIKey=JKNMCSVPNGHECQ-UHFFFAOYSA-N
SMILES:C[N]12[B+3]([O-]C(=O)C1)([O-]C(=O)C2)[C-]=3N(S(=O)(=O)C4=CC=CC=C4)C=5C(C3)=CC=CC5
Synonyms:- Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][1-(phenylsulfonyl)-1H-indol-2-yl]-, (T-4)-
- (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][1-(phenylsulfonyl)-1H-indol-2-yl]boron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][1-(phenylsulfonyl)-1H-indol-2-yl]-, (T-4)-
CAS:Formula:C19H17BN2O6SMolecular weight:412.2241
