CymitQuimica logo

CAS 1159-80-4

:

3-(5H-dibenzo[b,f]azepin-5-yl)-N,N,2-trimethylpropan-1-amine hydrochloride (1:1)

Description:
3-(5H-dibenzo[b,f]azepin-5-yl)-N,N,2-trimethylpropan-1-amine hydrochloride is a chemical compound characterized by its complex structure, which includes a dibenzo[b,f]azepine moiety, a nitrogen-containing amine group, and a trimethylpropan-1-amine component. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and other polar solvents. It is often studied for its potential pharmacological properties, particularly in the context of neuropharmacology, due to the presence of the dibenzoazepine structure, which is known to exhibit various biological activities. The compound may interact with neurotransmitter systems, making it of interest in the development of therapeutic agents for conditions such as depression or anxiety. Its molecular weight, melting point, and specific solubility characteristics can vary, but it is generally handled with care due to its bioactive nature. As with many chemical substances, proper safety protocols should be followed when handling this compound in laboratory settings.
Formula:C20H25ClN2
InChI:InChI=1/C20H24N2.ClH/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22;/h4-13,16H,14-15H2,1-3H3;1H
SMILES:CC(CN(C)C)CN1c2ccccc2C=Cc2ccccc12.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.