CAS 115900-06-6

4-(3-Bromophenyl)-1,2,3,6-tetrahydro-1-methylpyridine

Description:

4-(3-Bromophenyl)-1,2,3,6-tetrahydro-1-methylpyridine, with the CAS number 115900-06-6, is an organic compound characterized by its complex structure, which includes a tetrahydropyridine ring and a bromophenyl substituent. This compound features a nitrogen atom within a saturated six-membered ring, contributing to its basicity and potential for forming hydrogen bonds. The presence of the bromine atom on the phenyl group enhances its reactivity, making it a candidate for various chemical reactions, including electrophilic substitutions. The methyl group attached to the nitrogen atom influences the compound's steric and electronic properties, potentially affecting its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other solvents or reagents. Overall, this compound represents a unique structure that could be explored for various applications in organic synthesis and drug development.

Formula: C₁₂H₁₄BrN

InChI: InChI=1S/C12H14BrN/c1-14-7-5-10(6-8-14)11-3-2-4-12(13)9-11/h2-5,9H,6-8H2,1H3

InChI key: InChIKey=NNEZPRJPBBKDSR-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1)C=2CCN(C)CC2

Synonyms:

• Pyridine, 4-(3-bromophenyl)-1,2,3,6-tetrahydro-1-methyl-
• 1-Methyl-4-(3′-bromophenyl)-1,2,3,6-tetrahydropyridine
• 4-(3-Bromophenyl)-1,2,3,6-tetrahydro-1-methylpyridine

Pyridine, 4-(3-bromophenyl)-1,2,3,6-tetrahydro-1-methyl-

CAS: 115900-06-6

Formula: C₁₂H₁₄BrN

Molecular weight: 252.1503

Ref: IN-DA000H31