CAS 115900-75-9
:1,2-diethyl-3-hydroxypyridin-4-one
Description:
1,2-Diethyl-3-hydroxypyridin-4-one, with the CAS number 115900-75-9, is a chemical compound that belongs to the class of pyridinones. It features a pyridine ring substituted with two ethyl groups at the 1 and 2 positions and a hydroxyl group at the 3 position, along with a ketone functionality at the 4 position. This compound is known for its chelating properties, particularly with metal ions, which makes it of interest in various applications, including biochemistry and medicinal chemistry. It exhibits potential antioxidant activity and may play a role in metal ion homeostasis within biological systems. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the ethyl groups enhance its lipophilicity. Additionally, the compound's structural features may influence its biological activity, making it a subject of research in pharmacology and toxicology. Overall, 1,2-diethyl-3-hydroxypyridin-4-one is a versatile compound with potential applications in both industrial and pharmaceutical contexts.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c1-3-7-9(12)8(11)5-6-10(7)4-2/h5-6,12H,3-4H2,1-2H3
InChI key:InChIKey=XIYFEESCIBNMIC-UHFFFAOYSA-N
SMILES:C(C)C=1N(CC)C=CC(=O)C1O
Synonyms:- 1,2-Diethyl-3-hydroxypyridin-4-one
- 1,2-Diethyl-3-hydroxy-4(1H)-pyridinone
- CP94
- CGP 46700
- 4(1H)-Pyridinone, 1,2-diethyl-3-hydroxy-
- 1,2-diethyl-3-hydroxypyridin-4(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Diethyl-3-hydroxypyridin-4-one
CAS:1,2-Diethyl-3-hydroxypyridin-4-one (1,2DH) is a ligand that can bind to the HIF-1α protein and inhibit its activity. It has been shown to induce autophagy in cells exposed to hypoxia. 1,2DH is also an endomembrane molecule that modulates cancer autophagy and modulates angiogenesis. This compound is a hydroxylase inhibitor that inhibits the production of reactive oxygen species by converting hydrogen peroxide into water. It also prevents proteasomal degradation of proteins and modulates cancer cell proliferation by inhibiting the transcription factor HIF-1α.Formula:C9H13NO2Purity:Min. 95%Molecular weight:167.2 g/molCP94
CAS:CP94, an iron chelator, enhances protoporphyrin IX photobleaching and reduces the viability of A431 squamous epithelial carcinoma cells at a 150 µM concentration with photodynamic therapy (PDT) using protoporphyrin IX precursors such as aminolevulinic acid (ALA), methyl aminolevulinate (MAL), or hexylaminolevulinate (HAL). Additionally, CP94 (2 mg/ml in drinking water) lowers hepatic non-heme and ferritin-bound iron levels while increasing hepatic protoporphyrin levels in mice. It also counteracts ferrocene-induced rises in rat brain iron levels at a dosage of 100 mg/kg.Formula:C9H13NO2Color and Shape:SolidMolecular weight:167.205




