CAS 115909-93-8
:1-CBZ-3-(2-HYDROXY-ETHYL)-PIPERIDINE
Description:
1-CBZ-3-(2-Hydroxy-Ethyl)-Piperidine, with the CAS number 115909-93-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The "CBZ" refers to the carbobenzyloxy protecting group, indicating that the compound has a benzyl group attached to a carbonyl, which is typically used to protect amines during synthesis. The presence of a hydroxyethyl group at the 3-position of the piperidine ring introduces hydrophilicity and can influence the compound's solubility and reactivity. This compound may exhibit properties typical of piperidine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. Its structural features suggest it could be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's stability, reactivity, and potential applications in pharmaceuticals or as an intermediate in organic synthesis would depend on its specific functional groups and overall molecular structure.
Formula:C15H21NO3
InChI:InChI=1/C15H21NO3/c17-10-8-13-7-4-9-16(11-13)15(18)19-12-14-5-2-1-3-6-14/h1-3,5-6,13,17H,4,7-12H2/t13-/m1/s1
SMILES:c1ccc(cc1)COC(=O)N1CCC[C@H](CCO)C1
Synonyms:- 3-(2-Hydroxy-Ethyl)-Piperidine-1-Carboxylic Acid Benzyl Ester
- (R)-3-(2-Hydroxy-Ethyl)-Piperidine-1-Carboxylic Acid Benzyl Ester
- benzyl (3R)-3-(2-hydroxyethyl)piperidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
