CymitQuimica logo

CAS 115913-31-0

:

Bicyclo[1.1.1]pentane-1,3-dicarbonyl dichloride

Description:
Bicyclo[1.1.1]pentane-1,3-dicarbonyl dichloride is a chemical compound characterized by its bicyclic structure, which consists of a bicyclo[1.1.1]pentane framework with two carbonyl groups and two chlorine substituents. This compound typically exhibits reactivity associated with the presence of the carbonyl groups, making it a potential candidate for various synthetic applications, particularly in organic synthesis. The dichloride functional groups suggest that it can participate in nucleophilic substitution reactions, which may be useful in the formation of more complex molecules. Its unique bicyclic structure contributes to its physical properties, such as boiling and melting points, which may differ significantly from those of linear or more common cyclic compounds. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and solvent conditions. As with many chlorinated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C7H6Cl2O2
InChI:InChI=1S/C7H6Cl2O2/c8-4(10)6-1-7(2-6,3-6)5(9)11/h1-3H2
InChI key:InChIKey=UJCYQVOGBMCBSI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C12CC(C(Cl)=O)(C1)C2
Synonyms:
  • Bicyclo[1.1.1]pentane-1,3-dicarbonyl dichloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.