CymitQuimica logo

CAS 1159174-36-3

:

1-Heptanaminium, 7-bromo-N,N,N-trimethyl-, bromide (1:1)

Description:
1-Heptanaminium, 7-bromo-N,N,N-trimethyl-, bromide (1:1) is a quaternary ammonium compound characterized by its long hydrophobic heptane chain and a positively charged nitrogen atom. This substance features a trimethylated nitrogen, which contributes to its solubility in polar solvents and enhances its surfactant properties. The presence of the bromine atom at the 7-position of the heptane chain introduces halogen functionality, which can influence the compound's reactivity and interaction with biological systems. As a quaternary ammonium salt, it typically exhibits antimicrobial properties, making it useful in various applications, including disinfectants and preservatives. The compound's ionic nature allows it to form stable complexes with anions, such as bromide, which can affect its stability and solubility in different environments. Overall, 1-Heptanaminium, 7-bromo-N,N,N-trimethyl-, bromide (1:1) is notable for its surfactant characteristics, potential biological activity, and utility in industrial and pharmaceutical applications.
Formula:C10H23BrN·Br
InChI:InChI=1S/C10H23BrN.BrH/c1-12(2,3)10-8-6-4-5-7-9-11;/h4-10H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=DKZPHMNXOPCINV-UHFFFAOYSA-M
SMILES:C(CCCCCCBr)[N+](C)(C)C.[Br-]
Synonyms:
  • 1-Heptanaminium, 7-bromo-N,N,N-trimethyl-, bromide (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.