
CAS 1159186-57-8
:1-Bromo-3-(chloromethyl)-2,5-difluorobenzene
Description:
1-Bromo-3-(chloromethyl)-2,5-difluorobenzene is an organic compound characterized by its halogenated aromatic structure. It features a benzene ring substituted with a bromine atom, a chloromethyl group, and two fluorine atoms at the 2 and 5 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. Its halogen substituents contribute to its reactivity, making it useful in various chemical synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. The presence of multiple electronegative halogens can influence its polarity, solubility, and boiling point, often making it more soluble in organic solvents than in water. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and analysis. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H4BrClF2
InChI:InChI=1S/C7H4BrClF2/c8-6-2-5(10)1-4(3-9)7(6)11/h1-2H,3H2
InChI key:InChIKey=KINXRNLTTQXYMW-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(F)C(Br)=CC(F)=C1
Synonyms:- Benzene, 1-bromo-3-(chloromethyl)-2,5-difluoro-
- 1-Bromo-3-(chloromethyl)-2,5-difluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
