CAS 115919-14-7
:6-METHYL-2-PYRIDINEGLYCOLIC ACID
Description:
6-Methyl-2-pyridineglycolic acid, identified by its CAS number 115919-14-7, is an organic compound characterized by the presence of a pyridine ring and a carboxylic acid functional group. This compound features a methyl group at the 6-position of the pyridine ring, which influences its chemical reactivity and solubility. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, due to the presence of the hydroxyl and carboxylic acid groups. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with various biological targets, which could lead to applications in medicinal chemistry. Additionally, the presence of the pyridine moiety may contribute to its ability to form coordination complexes with metal ions. As with many organic acids, it may exhibit acidic properties, influencing its behavior in different pH environments. Overall, 6-methyl-2-pyridineglycolic acid is a compound of interest in both synthetic and biological chemistry contexts.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-5-3-2-4-6(9-5)7(10)8(11)12/h2-4,7,10H,1H3,(H,11,12)
Synonyms:- 2-pyridineacetic acid, α-hydroxy-6-methyl-
- 2-hydroxy-2-(6-methyl-2-pyridyl)acetic acid
- Hydroxy(6-methylpyridin-2-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
