CymitQuimica logo

CAS 115931-01-6

:

N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]acetamide

Description:
N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]acetamide, with the CAS number 115931-01-6, is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine moiety and an acetamide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the cyanopyrazolo group suggests potential interactions with biological targets, possibly influencing its pharmacological profile. Its molecular structure may confer specific reactivity patterns, stability under various conditions, and the ability to form hydrogen bonds, which can be crucial for its function in biological systems. Additionally, the compound may undergo various chemical transformations, depending on the conditions, which could affect its efficacy and safety in applications. Overall, N-[3-(3-cyanopyrazolo[1,5-a]pyrimidin-7-yl)phenyl]acetamide represents a class of compounds that could be explored for therapeutic uses, particularly in the context of targeted drug design.
Formula:C15H11N5O
InChI:InChI=1/C15H11N5O/c1-10(21)19-13-4-2-3-11(7-13)14-5-6-17-15-12(8-16)9-18-20(14)15/h2-7,9H,1H3,(H,19,21)
SMILES:CC(=Nc1cccc(c1)c1ccnc2c(C#N)cnn12)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.