CAS 115948-88-4

α-Ethyl-1,4-dihydro-2,4-dioxo-3(2H)-quinazolineacetic acid

Description:

α-Ethyl-1,4-dihydro-2,4-dioxo-3(2H)-quinazolineacetic acid, with the CAS number 115948-88-4, is a chemical compound that belongs to the class of quinazoline derivatives. This substance typically exhibits a bicyclic structure, characterized by a quinazoline ring fused with a carboxylic acid moiety. The presence of two carbonyl groups contributes to its potential reactivity and biological activity. It is often studied for its pharmacological properties, including potential anti-inflammatory and analgesic effects. The ethyl group enhances its lipophilicity, which may influence its absorption and distribution in biological systems. Additionally, the compound may exhibit solubility in organic solvents, while its acidic nature suggests it can participate in various chemical reactions, including esterification and amidation. Overall, α-Ethyl-1,4-dihydro-2,4-dioxo-3(2H)-quinazolineacetic acid is of interest in medicinal chemistry and drug development due to its unique structural features and potential therapeutic applications.

Formula: C₁₂H₁₂N₂O₄

InChI: InChI=1S/C12H12N2O4/c1-2-9(11(16)17)14-10(15)7-5-3-4-6-8(7)13-12(14)18/h3-6,9H,2H2,1H3,(H,13,18)(H,16,17)

InChI key: InChIKey=LAALKUNVPQKOCW-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(=O)N1C(C(O)=O)CC)=CC=CC2

Synonyms:

• 3(2H)-Quinazolineacetic acid, α-ethyl-1,4-dihydro-2,4-dioxo-
• 2-(2-Hydroxy-4-oxo-4H-quinazolin-3-yl)-butyric acid
• 2-(2,4-Dioxo-1,4-dihydroquinazolin-3(2H)-yl)butanoic acid
• 2-(2,4-Dioxo-1,2,3,4-tetrahydroquinazolin-3-yl)butanoic acid
• α-Ethyl-1,4-dihydro-2,4-dioxo-3(2H)-quinazolineacetic acid