CAS 115948-90-8

1,4-Dihydro-2,4-dioxo-α-(phenylmethyl)-3(2H)-quinazolineacetic acid

Description:

1,4-Dihydro-2,4-dioxo-α-(phenylmethyl)-3(2H)-quinazolineacetic acid, with CAS number 115948-90-8, is a synthetic organic compound that belongs to the class of quinazoline derivatives. This compound features a quinazoline core, which is characterized by a fused bicyclic structure containing both benzene and pyrimidine rings. The presence of two carbonyl groups (dioxo) contributes to its potential reactivity and biological activity. The α-(phenylmethyl) substituent indicates the presence of a phenyl group attached to a methylene bridge, which can influence the compound's lipophilicity and interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₇H₁₄N₂O₄

InChI: InChI=1S/C17H14N2O4/c20-15-12-8-4-5-9-13(12)18-17(23)19(15)14(16(21)22)10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,18,23)(H,21,22)

InChI key: InChIKey=JSHKCLVDTGIHEU-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(C(O)=O)N2C(=O)C=3C(NC2=O)=CC=CC3

Synonyms:

• 1,4-Dihydro-2,4-dioxo-α-(phenylmethyl)-3(2H)-quinazolineacetic acid
• 3(2H)-Quinazolineacetic acid, 1,4-dihydro-2,4-dioxo-α-(phenylmethyl)-