CymitQuimica logo

CAS 1159489-38-9

:

Benzenepropanenitrile, α-amino-4-iodo-, hydrochloride (1:1), (αS)-

Description:
Benzenepropanenitrile, α-amino-4-iodo-, hydrochloride (1:1), (αS)-, is a chemical compound characterized by its structural features that include a benzene ring, a propanenitrile group, and an amino group with an iodine substituent at the para position. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical chemistry. The presence of the amino group suggests potential for biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. The specific stereochemistry indicated by (αS)- denotes the configuration of the chiral center, which can influence the compound's biological interactions and pharmacological properties. As with many halogenated compounds, the iodine atom may impart unique reactivity and stability characteristics. Overall, this compound's properties and behavior in chemical reactions are influenced by its functional groups and molecular structure, making it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C9H9IN2·ClH
InChI:InChI=1S/C9H9IN2.ClH/c10-8-3-1-7(2-4-8)5-9(12)6-11;/h1-4,9H,5,12H2;1H/t9-;/m0./s1
InChI key:InChIKey=XVXWSENRIJBQOP-FVGYRXGTSA-N
SMILES:C([C@@H](C#N)N)C1=CC=C(I)C=C1.Cl
Synonyms:
  • (s)-2-Amino-3-(4-iodophenyl)propanenitrile hydrochloride
  • Benzenepropanenitrile, α-amino-4-iodo-, hydrochloride (1:1), (αS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.