CAS 1159511-30-4
:Ethanone, 1-(2-methyl-2H-indazol-7-yl)-
Description:
Ethanone, 1-(2-methyl-2H-indazol-7-yl)-, also known by its CAS number 1159511-30-4, is an organic compound characterized by its indazole structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. This compound features a ketone functional group (ethanone) attached to the indazole moiety, specifically at the 1-position. The presence of the methyl group at the 2-position of the indazole ring contributes to its unique chemical properties and potential biological activity. Ethanone derivatives often exhibit interesting pharmacological properties, making them subjects of research in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the presence of the indazole ring, which can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Overall, this compound's structural features suggest potential applications in drug development and other chemical syntheses.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-7(13)9-5-3-4-8-6-12(2)11-10(8)9/h3-6H,1-2H3
InChI key:InChIKey=UPNZBUHIUFAUGN-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=2C(=CN(C)N2)C=CC1
Synonyms:- Ethanone, 1-(2-methyl-2H-indazol-7-yl)-
- 1-(2-Methyl-2H-indazol-7-yl)ethan-1-one
- 1-(2-Methyl-2H-indazol-7-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
7-Acetyl-2-methyl-2H-indazole
CAS:<p>7-Acetyl-2-methyl-2H-indazole</p>Color and Shape:SolidMolecular weight:174.20g/mol

