CAS 1159512-59-0: 1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene

Description: 1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene is an organic compound characterized by its complex structure, which includes a bromomethyl group, a fluorine atom, and a trifluoromethoxy group attached to a benzene ring. This compound is likely to exhibit significant reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The trifluoromethoxy group contributes to its overall polarity and may influence its solubility in various solvents. Additionally, the fluorine substituent can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of multiple electronegative atoms suggests that the compound may exhibit unique intermolecular interactions, such as hydrogen bonding or dipole-dipole interactions. Overall, this compound's distinctive functional groups and structural features make it a valuable subject for further study in synthetic chemistry and material science.

Formula: C₈H₅BrF₄O

InChI: InChI=1S/C8H5BrF4O/c9-4-5-2-1-3-6(7(5)10)14-8(11,12)13/h1-3H,4H2

InChI key: InChIKey=YCLRETLTIMECAI-UHFFFAOYSA-N

SMILES: FC=1C(OC(F)(F)F)=CC=CC1CBr

2-Fluoro-3-(trifluoromethoxy)benzyl bromide

CAS: 1159512-59-0

• Formula: C₈H₅BrF₄O
• Purity: 95%
• Color and Shape: clear. almost colourless liquid
• Molecular weight: 273.02g/mol

1-(Bromomethyl)-2-fluoro-3-(trifluoromethoxy)benzene

CAS: 1159512-59-0

Versatile small molecule scaffold

• Formula: C₈H₅BrF₄O
• Purity: Min. 95%
• Molecular weight: 273.02 g/mol