CAS 1159512-66-9: 2-Fluoro-5-iodoacetophenone

Description:2-Fluoro-5-iodoacetophenone is an organic compound characterized by the presence of both fluorine and iodine substituents on the aromatic ring of acetophenone. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atom, being electronegative, can influence the electronic properties of the molecule, potentially enhancing its reactivity in nucleophilic substitution reactions. The iodine substituent, on the other hand, can facilitate various coupling reactions due to its ability to participate in halogen exchange processes. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals and agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the presence of the halogen atoms and the acetophenone structure. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Fluoro-5-iodoacetophenone is a valuable intermediate in the field of synthetic organic chemistry.

Formula:C₈H₆FIO

InChI:InChI=1S/C8H6FIO/c1-5(11)7-4-6(10)2-3-8(7)9/h2-4H,1H3

InChI key:InChIKey=PAAFYGBEQFBNDA-UHFFFAOYSA-N

SMILES:O=C(C1=CC(I)=CC=C1F)C

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(2-Fluoro-5-iodophenyl)ethan-1-one REF: 10-F608537CAS: 1159512-66-9	97%	51.00 €~222.00 €	Tue 29 Apr 25
2'-FLUORO-5'-IODOACETOPHENONE REF: IN-DA00HD4VCAS: 1159512-66-9	97%	44.00 €~211.00 €	Tue 06 May 25
2'-Fluoro-5'-iodoacetophenone REF: 54-PC6378CAS: 1159512-66-9	99%	84.00 €~293.00 €	Wed 07 May 25
2'-Fluoro-5'-iodoacetophenone REF: 3D-JWB51266CAS: 1159512-66-9	Min. 95%	- - -	Discontinued product