CAS 115956-03-1
:9-Azabicyclo[3.3.1]Nonane-9-Acetic Acid, 3-(Ethoxycarbonyl)-7-Oxo-, Ethyl Ester
Description:
9-Azabicyclo[3.3.1]nonane-9-acetic acid, 3-(ethoxycarbonyl)-7-oxo-, ethyl ester, identified by CAS number 115956-03-1, is a bicyclic compound featuring a nitrogen atom within its ring structure, which contributes to its unique chemical properties. This compound exhibits characteristics typical of both bicyclic amines and carboxylic acids, including potential basicity due to the nitrogen atom and reactivity associated with the carboxylic acid functional group. The presence of the ethoxycarbonyl and ethyl ester groups suggests that it may participate in various chemical reactions, such as esterification and acylation. Its structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the bicyclic framework that can influence biological activity. Additionally, the compound's solubility and stability may be affected by the ester and carboxylic acid functionalities, making it of interest for further research in organic synthesis and drug formulation. Overall, this compound represents a complex structure with diverse potential applications in chemical and pharmaceutical research.
Formula:C15H23NO5
InChI:InChI=1/C15H23NO5/c1-3-20-14(18)9-16-11-5-10(15(19)21-4-2)6-12(16)8-13(17)7-11/h10-12H,3-9H2,1-2H3
InChI key:InChIKey=JCXUVTNCQZYKOG-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)N1C2CC(C(OCC)=O)CC1CC(=O)C2
Synonyms:- 3-(Ethoxycarbonyl)-7-oxo-9-azabicyclo[3.3.1]nonane-9-aceticacidethylester
- Ethyl 3-(ethoxycarbonyl)-7-oxo-9-azabicyclo[3.3.1]nonane-9-acetate
- Ethyl 9-(2-Ethoxy-2-Oxoethyl)-7-Oxo-9-Azabicyclo[3.3.1]Nonane-3-Carboxylate
- 9-Azabicyclo[3.3.1]nonane-9-acetic acid, 3-(ethoxycarbonyl)-7-oxo-, ethyl ester
- Dolasetron Impurity 3
- Dolasetron Impurity 5
- Dolasetron Impurity
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
