CAS 1159596-88-9

Methyl 5-[1,1′-biphenyl]-4-yl-1H-pyrazole-3-carboxylate

Description:

Methyl 5-[1,1′-biphenyl]-4-yl-1H-pyrazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a biphenyl moiety. This compound typically exhibits properties associated with both the pyrazole and carboxylate functional groups, such as potential biological activity and solubility in organic solvents. The presence of the methyl ester group suggests that it may participate in esterification reactions and could be hydrolyzed to release the corresponding carboxylic acid. The biphenyl structure may contribute to its stability and influence its interactions with other molecules, potentially affecting its reactivity and biological activity. Additionally, compounds of this nature are often investigated for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and industry.

Formula: C₁₇H₁₄N₂O₂

InChI: InChI=1S/C17H14N2O2/c1-21-17(20)16-11-15(18-19-16)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-11H,1H3,(H,18,19)

InChI key: InChIKey=MLNDJPYVJPUGQC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(NN1)C2=CC=C(C=C2)C3=CC=CC=C3

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 5-[1,1′-biphenyl]-4-yl-, methyl ester
• Methyl 5-[1,1′-biphenyl]-4-yl-1H-pyrazole-3-carboxylate