CAS 1159599-99-1
:2-oxa-6-azaspiro[3,3]heptanes oxalic acid salt
Description:
2-Oxa-6-azaspiro[3,3]heptanes oxalic acid salt is a chemical compound characterized by its unique spirocyclic structure, which includes both an oxo and an azaspiro moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for salts, and may display biological activity due to its structural features. The presence of the oxalic acid moiety suggests that it can form stable salts, potentially influencing its reactivity and interaction with other chemical species. Additionally, the spirocyclic framework may contribute to its conformational rigidity, affecting its pharmacokinetic properties if it has biological applications. The compound's CAS number, 1159599-99-1, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, 2-oxa-6-azaspiro[3,3]heptanes oxalic acid salt represents a class of compounds that may have potential uses in medicinal chemistry or materials science, although specific applications would depend on further research and characterization.
Formula:C7H11NO5
InChI:InChI=1S/C5H9NO.C2H2O4/c1-5(2-6-1)3-7-4-5;3-1(4)2(5)6/h6H,1-4H2;(H,3,4)(H,5,6)
SMILES:C1C2(CN1)COC2.C(=O)(C(=O)O)O
Synonyms:- 2-Oxa-6-azaspiro[3.3]heptane ethanedioate (1:1)
- 2-Oxa-6-Azaspiro[3.3]Heptane Oxalate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Oxa-6-azaspiro[3.3]heptane oxalate, 97%
CAS:2-Oxa-6-azaspiro[3.3]heptane oxalate used as a intermediate in pharmaceutical and chemical synthesis. Also used in medicine. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand.Formula:C5H9NO·C2H2O4H2C6H11NOPurity:97%Molecular weight:189.172-Oxa-6-azaspiro[3.3]heptane, ethanedioate (1:1)
CAS:Formula:C7H11NO5Purity:95%Color and Shape:SolidMolecular weight:189.16592-Oxa-6-azaspiro[3.3]heptane oxalate
CAS:2-Oxa-6-azaspiro[3.3]heptane oxalatePurity:95%Molecular weight:189.17g/mol2-Oxa-6-azaspiro[3.3]heptane oxalate
CAS:Formula:C7H11NO5Purity:95%Color and Shape:Solid, White powderMolecular weight:189.167



