CymitQuimica logo

CAS 1159600-05-1

:

3-(2-Fluorophenyl)-5-methyl-4-isoxazolemethanol

Description:
3-(2-Fluorophenyl)-5-methyl-4-isoxazolemethanol is a chemical compound characterized by its unique isoxazole structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of a fluorophenyl group indicates that the compound has a fluorine atom substituted on a phenyl ring, which can influence its electronic properties and reactivity. The methyl group attached to the isoxazole ring contributes to its hydrophobic characteristics, potentially affecting its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, particularly the fluorine atom, which can enhance lipophilicity and alter binding affinities in biological systems. Overall, 3-(2-Fluorophenyl)-5-methyl-4-isoxazolemethanol represents a class of compounds that may have applications in drug development and material science, warranting further investigation into its properties and potential uses.
Formula:C11H10FNO2
InChI:InChI=1S/C11H10FNO2/c1-7-9(6-14)11(13-15-7)8-4-2-3-5-10(8)12/h2-5,14H,6H2,1H3
InChI key:InChIKey=OWSBMDKEUMMGNW-UHFFFAOYSA-N
SMILES:C(O)C=1C(=NOC1C)C2=C(F)C=CC=C2
Synonyms:
  • 4-Isoxazolemethanol, 3-(2-fluorophenyl)-5-methyl-
  • [3-(2-Fluorophenyl)-5-methylisoxazol-4-yl]methanol
  • 3-(2-Fluorophenyl)-5-methyl-4-isoxazolemethanol
  • [3-(2-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.