CAS 1159607-50-7
:1-(Chloromethyl)-2-fluoro-4-nitrobenzene
Description:
1-(Chloromethyl)-2-fluoro-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloromethyl group, a fluoro group, and a nitro group. The presence of these substituents imparts distinct chemical properties to the compound. The chloromethyl group enhances its reactivity, making it a potential intermediate in various organic synthesis reactions. The fluoro group contributes to the compound's polarity and can influence its solubility in different solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. This compound is typically used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. It may exhibit moderate to high toxicity, necessitating careful handling and storage. Additionally, its physical properties, such as boiling point and melting point, are influenced by the arrangement and nature of its substituents, which can also affect its behavior in chemical reactions. Overall, 1-(Chloromethyl)-2-fluoro-4-nitrobenzene is a versatile compound with significant applications in chemical synthesis.
Formula:C7H5ClFNO2
InChI:InChI=1S/C7H5ClFNO2/c8-4-5-1-2-6(10(11)12)3-7(5)9/h1-3H,4H2
InChI key:InChIKey=HIDSJCQJOQDPEO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(F)=C(CCl)C=C1
Synonyms:- 1-(Chloromethyl)-2-fluoro-4-nitrobenzene
- Benzene, 1-(chloromethyl)-2-fluoro-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
