
CAS 1159678-53-1
:5-Amino-1-(4-fluoro-2-methylphenyl)-1H-pyrazole-4-carbonitrile
Description:
5-Amino-1-(4-fluoro-2-methylphenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amino group (-NH2) and a carbonitrile group (-C≡N) that contribute to its reactivity and potential applications in medicinal chemistry. The presence of a 4-fluoro-2-methylphenyl substituent enhances its lipophilicity and may influence its biological activity. The fluorine atom can also affect the compound's electronic properties, potentially improving its binding affinity to biological targets. This compound may exhibit various pharmacological properties, making it of interest in drug discovery and development. Its structural characteristics suggest potential applications in areas such as anti-inflammatory or anticancer therapies, although specific biological activities would need to be evaluated through experimental studies. As with many pyrazole derivatives, it may also serve as a scaffold for further chemical modifications to optimize its therapeutic potential.
Formula:C11H9FN4
InChI:InChI=1S/C11H9FN4/c1-7-4-9(12)2-3-10(7)16-11(14)8(5-13)6-15-16/h2-4,6H,14H2,1H3
InChI key:InChIKey=CMNVHFFKPLAZKU-UHFFFAOYSA-N
SMILES:NC=1N(N=CC1C#N)C2=C(C)C=C(F)C=C2
Synonyms:- 5-Amino-1-(4-fluoro-2-methylphenyl)-1H-pyrazole-4-carbonitrile
- 1H-Pyrazole-4-carbonitrile, 5-amino-1-(4-fluoro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.