
CAS 1159698-17-5
:2-Butanamine, N-(3-phenyl-2-propen-1-yl)-, hydrochloride (1:1)
Description:
2-Butanamine, N-(3-phenyl-2-propen-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a phenyl-substituted propenyl moiety. This substance is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of the butanamine backbone suggests it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The phenyl group contributes to its potential for aromatic interactions, which can influence its biological activity and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Additionally, the hydrochloride form is commonly used in pharmaceutical formulations to improve the compound's bioavailability. As with many amines, it may exhibit varying degrees of toxicity and should be handled with appropriate safety precautions in laboratory settings. Overall, its unique structure and properties make it a candidate for further research in chemical and biological applications.
Formula:C13H19N·ClH
InChI:InChI=1S/C13H19N.ClH/c1-3-12(2)14-11-7-10-13-8-5-4-6-9-13;/h4-10,12,14H,3,11H2,1-2H3;1H
InChI key:InChIKey=AQANOAUJRUSGAV-UHFFFAOYSA-N
SMILES:C(=CCNC(CC)C)C1=CC=CC=C1.Cl
Synonyms:- 2-Butanamine, N-(3-phenyl-2-propen-1-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.