CymitQuimica logo

CAS 1159706-33-8

:

3-Hydroxy-5-methyl-2(1H)-quinolinone

Description:
3-Hydroxy-5-methyl-2(1H)-quinolinone, also known by its CAS number 1159706-33-8, is a chemical compound characterized by a quinolinone structure, which is a bicyclic compound containing a quinoline and a ketone functional group. This substance typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. The presence of the hydroxyl and methyl groups contributes to its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, the compound's stability, melting point, and spectral characteristics (such as UV-Vis and NMR) are essential for its identification and application in research. Overall, 3-Hydroxy-5-methyl-2(1H)-quinolinone represents a valuable compound for further investigation in various chemical and biological contexts.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-6-3-2-4-8-7(6)5-9(12)10(13)11-8/h2-5,12H,1H3,(H,11,13)
InChI key:InChIKey=NRNHMRFPCJTZAW-UHFFFAOYSA-N
SMILES:CC1=C2C(NC(=O)C(O)=C2)=CC=C1
Synonyms:
  • 3-Hydroxy-5-methyl-2(1H)-quinolinone
  • 3-Hydroxy-5-methyl-1H-quinolin-2-one
  • 2(1H)-Quinolinone, 3-hydroxy-5-methyl-
  • 3-Hydroxy-5-methyl-1,2-dihydroquinolin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.