CymitQuimica logo

CAS 1159733-51-3

:

1-(4-Oxazolyl)cyclopropanamine

Description:
1-(4-Oxazolyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an oxazole moiety. The presence of the oxazole ring, a five-membered heterocyclic compound containing nitrogen and oxygen, contributes to its potential biological activity and reactivity. This compound is typically classified as an amine due to the presence of the amine functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The cyclopropane ring adds strain to the molecular structure, which can enhance reactivity in certain chemical reactions. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and behavior in biological systems would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. As with many heterocyclic compounds, the synthesis and characterization of 1-(4-Oxazolyl)cyclopropanamine are crucial for understanding its potential uses in various chemical and pharmaceutical applications.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c7-6(1-2-6)5-3-9-4-8-5/h3-4H,1-2,7H2
InChI key:InChIKey=WNVGHPMPARPTKY-UHFFFAOYSA-N
SMILES:NC1(CC1)C2=COC=N2
Synonyms:
  • 1-(1,3-Oxazol-4-yl)cyclopropan-1-amine
  • Cyclopropanamine, 1-(4-oxazolyl)-
  • 1-Oxazol-4-yl-cyclopropylamine
  • 1-(4-Oxazolyl)cyclopropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.