CAS 1159803-51-6
:2,3-Dihydro-2-(3-methylphenyl)-1H-naphtho[1,8-de]-1,3,2-diazaborine
Description:
2,3-Dihydro-2-(3-methylphenyl)-1H-naphtho[1,8-de]-1,3,2-diazaborine is a complex organic compound that features a naphtho[1,8-de] structure fused with a diazaborine moiety. This compound is characterized by the presence of a boron atom, which is integral to its chemical properties, particularly in coordination chemistry and potential applications in materials science. The presence of the 3-methylphenyl group contributes to its hydrophobic characteristics and may influence its solubility and reactivity. The compound's structure suggests potential applications in organic electronics, photonics, or as a precursor in synthetic chemistry due to the unique electronic properties imparted by the boron-nitrogen framework. Additionally, the presence of the naphthalene ring system may provide interesting photophysical properties, making it a candidate for studies in luminescence or as a dye. Overall, the unique structural features of this compound make it a subject of interest in various fields of research, including organic synthesis and materials science.
Formula:C17H15BN2
InChI:InChI=1S/C17H15BN2/c1-12-5-2-8-14(11-12)18-19-15-9-3-6-13-7-4-10-16(20-18)17(13)15/h2-11,19-20H,1H3
InChI key:InChIKey=WWOCDJPTCDLFMK-UHFFFAOYSA-N
SMILES:CC=1C=C(B2NC=3C=4C(N2)=CC=CC4C=CC3)C=CC1
Synonyms:- 2-(3-Methylphenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
- 2,3-Dihydro-2-(3-methylphenyl)-1H-naphtho[1,8-de]-1,3,2-diazaborine
- 1H-Naphtho[1,8-de]-1,3,2-diazaborine, 2,3-dihydro-2-(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-Methylphenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
CAS:<p>2-(3-Methylphenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine</p>Molecular weight:258.13g/mol
