CAS 1159803-56-1
:2,3-Dihydro-2-(3-methoxyphenyl)-1H-naphtho[1,8-de]-1,3,2-diazaborine
Description:
2,3-Dihydro-2-(3-methoxyphenyl)-1H-naphtho[1,8-de]-1,3,2-diazaborine is a complex organic compound that features a naphthoborine structure, which incorporates both boron and nitrogen atoms within its framework. This compound is characterized by its unique bicyclic structure, which includes a naphthalene moiety fused with a diazaborine unit. The presence of the methoxyphenyl group enhances its solubility and may influence its electronic properties, making it of interest in various applications, including organic electronics and materials science. The boron atom in the structure can participate in coordination chemistry, potentially allowing for interactions with other molecules or ions. Additionally, the compound may exhibit interesting photophysical properties, which could be leveraged in light-emitting devices or sensors. Its synthesis and characterization are important for understanding its reactivity and potential applications in fields such as medicinal chemistry and materials development. As with many boron-containing compounds, it may also exhibit unique properties related to its Lewis acidity and ability to form complexes.
Formula:C17H15BN2O
InChI:InChI=1S/C17H15BN2O/c1-21-14-8-4-7-13(11-14)18-19-15-9-2-5-12-6-3-10-16(20-18)17(12)15/h2-11,19-20H,1H3
InChI key:InChIKey=KQWSJBNQJNULIJ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(B2NC=3C=4C(N2)=CC=CC4C=CC3)C=CC1
Synonyms:- 1H-Naphtho[1,8-de]-1,3,2-diazaborine, 2,3-dihydro-2-(3-methoxyphenyl)-
- 2,3-Dihydro-2-(3-methoxyphenyl)-1H-naphtho[1,8-de]-1,3,2-diazaborine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-Methyoxyphenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
CAS:<p>2-(3-Methyoxyphenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine</p>Molecular weight:274.12g/mol
