CAS 1159811-37-6

1H-Benzimidazole-6-carboxylic acid, 2-amino-, hydrobromide (1:1)

Description:

1H-Benzimidazole-6-carboxylic acid, 2-amino-, hydrobromide (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a carboxylic acid group and an amino group contributes to its acidic and basic properties, making it a zwitterionic compound in certain conditions. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents, which is beneficial for various applications in pharmaceuticals and biochemistry. This compound may exhibit biological activity, potentially serving as a scaffold for drug development due to its structural features. Its molecular interactions can be influenced by the functional groups present, allowing for potential applications in medicinal chemistry. As with many benzimidazole derivatives, it may also display properties such as antimicrobial or antifungal activity, although specific biological effects would require further investigation. Safety data and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₈H₇N₃O₂·BrH

InChI: InChI=1S/C8H7N3O2.BrH/c9-8-10-5-2-1-4(7(12)13)3-6(5)11-8;/h1-3H,(H,12,13)(H3,9,10,11);1H

InChI key: InChIKey=GYLQPRQKIZGJMW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=CC1)N=C(N)N2.Br

Synonyms:

• 1H-Benzimidazole-6-carboxylic acid, 2-amino-, hydrobromide (1:1)