CymitQuimica logo

CAS 1159814-10-4

:

6-Cyclopentyl-3-pyridazinamine

Description:
6-Cyclopentyl-3-pyridazinamine is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a cyclopentyl group. Pyridazines are a class of heterocyclic compounds containing two nitrogen atoms in a six-membered ring, which contributes to the compound's reactivity and potential biological activity. The presence of the cyclopentyl group can influence the compound's lipophilicity and steric properties, potentially affecting its interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Additionally, the compound's CAS number, 1159814-10-4, allows for precise identification and retrieval of information in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Further studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c10-9-6-5-8(11-12-9)7-3-1-2-4-7/h5-7H,1-4H2,(H2,10,12)
InChI key:InChIKey=QJCDTTYMWMKSSF-UHFFFAOYSA-N
SMILES:NC1=CC=C(N=N1)C2CCCC2
Synonyms:
  • 6-Cyclopentyl-3-pyridazinamine
  • 3-Pyridazinamine, 6-cyclopentyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.