CymitQuimica logo

CAS 1159814-12-6

:

2-Bromo-5-cyclobutylthiazole

Description:
2-Bromo-5-cyclobutylthiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the second position and a cyclobutyl group at the fifth position of the thiazole ring. This structural arrangement contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the bromine atom can enhance electrophilic reactivity, making it useful in various synthetic applications. Additionally, the cyclobutyl group introduces a degree of strain and rigidity to the molecule, which may influence its interactions with biological targets or other chemical species. 2-Bromo-5-cyclobutylthiazole may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in the development of novel compounds. As with many thiazole derivatives, it may exhibit properties such as antimicrobial or antifungal activity, although specific biological data would need to be evaluated for comprehensive insights.
Formula:C7H8BrNS
InChI:InChI=1S/C7H8BrNS/c8-7-9-4-6(10-7)5-2-1-3-5/h4-5H,1-3H2
InChI key:InChIKey=WDFGAENRMWIZNB-UHFFFAOYSA-N
SMILES:BrC=1SC(=CN1)C2CCC2
Synonyms:
  • 2-Bromo-5-cyclobutylthiazole
  • Thiazole, 2-bromo-5-cyclobutyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.