
CAS 1159814-31-9
:5-Bromo-2-(3-fluorophenyl)thiazole
Description:
5-Bromo-2-(3-fluorophenyl)thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the 5-position and a 3-fluorophenyl group at the 2-position of the thiazole ring, contributing to its unique chemical properties. This substitution pattern can influence its reactivity, solubility, and biological activity. The presence of the bromine and fluorine atoms typically enhances the compound's lipophilicity and may affect its interaction with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, thiazole derivatives are known for their diverse applications, including antimicrobial, antifungal, and anticancer activities. The compound's molecular structure allows for potential interactions with various biological pathways, making it a subject of research in pharmacology and material science. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C9H5BrFNS
InChI:InChI=1S/C9H5BrFNS/c10-8-5-12-9(13-8)6-2-1-3-7(11)4-6/h1-5H
InChI key:InChIKey=IEKUAMMKJANLGT-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C2=NC=C(Br)S2
Synonyms:- Thiazole, 5-bromo-2-(3-fluorophenyl)-
- 5-Bromo-2-(3-fluorophenyl)thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.