CAS 1159814-68-2

4-Bromo-2-(1H-pyrazol-1-yl)pyridine

Description:

4-Bromo-2-(1H-pyrazol-1-yl)pyridine is a heterocyclic organic compound characterized by its pyridine and pyrazole moieties. The presence of a bromine atom at the 4-position of the pyridine ring enhances its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. This compound typically exhibits a pale to light-colored solid form and is soluble in polar organic solvents. Its molecular structure contributes to its potential as a ligand in coordination chemistry and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The pyrazole group can impart biological activity, making this compound of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics (NMR, IR, etc.), can vary based on purity and environmental conditions. Safety data should be consulted, as brominated compounds can pose health risks, and appropriate handling and disposal measures should be followed. Overall, 4-Bromo-2-(1H-pyrazol-1-yl)pyridine is a versatile compound with significant implications in research and industry.

Formula: C₈H₆BrN₃

InChI: InChI=1S/C8H6BrN3/c9-7-2-4-10-8(6-7)12-5-1-3-11-12/h1-6H

InChI key: InChIKey=AVRRINUBVDRHNB-UHFFFAOYSA-N

SMILES: BrC=1C=C(N=CC1)N2C=CC=N2

Synonyms:

• 4-Bromo-2-(1H-pyrazol-1-yl)pyridine
• Pyridine, 4-bromo-2-(1H-pyrazol-1-yl)-