
CAS 1159814-98-8
:4-Bromo-2-(tetrahydro-3-furanyl)thiazole
Description:
4-Bromo-2-(tetrahydro-3-furanyl)thiazole is a heterocyclic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine substituent at the 4-position and a tetrahydrofuran moiety attached at the 2-position, contributing to its unique chemical properties. This structure suggests potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The tetrahydrofuran group may enhance solubility in organic solvents and influence the compound's overall polarity. Additionally, thiazole derivatives are known for their biological activity, making this compound of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the electronic effects of the bromine and the ring structure. Overall, 4-Bromo-2-(tetrahydro-3-furanyl)thiazole represents a complex chemical entity with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H8BrNOS
InChI:InChI=1S/C7H8BrNOS/c8-6-4-11-7(9-6)5-1-2-10-3-5/h4-5H,1-3H2
InChI key:InChIKey=ANLOJPXKDMEGFC-UHFFFAOYSA-N
SMILES:BrC=1N=C(SC1)C2CCOC2
Synonyms:- Thiazole, 4-bromo-2-(tetrahydro-3-furanyl)-
- 4-Bromo-2-(tetrahydro-3-furanyl)thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.