CymitQuimica logo

CAS 1159815-76-5

:

2-Cyclohexyl-4-thiazolamine

Description:
2-Cyclohexyl-4-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a cyclohexyl group, contributing to its hydrophobic characteristics, and an amino group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry for the development of pharmaceuticals. The presence of the amino group suggests potential reactivity, making it a candidate for further chemical modifications. Additionally, compounds like 2-Cyclohexyl-4-thiazolamine may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific biological data would depend on empirical studies. Its molecular structure and functional groups suggest potential applications in drug development, agrochemicals, or as intermediates in organic synthesis. As with any chemical substance, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.
Formula:C9H14N2S
InChI:InChI=1S/C9H14N2S/c10-8-6-12-9(11-8)7-4-2-1-3-5-7/h6-7H,1-5,10H2
InChI key:InChIKey=WJDDKVPDODORBB-UHFFFAOYSA-N
SMILES:NC=1N=C(SC1)C2CCCCC2
Synonyms:
  • 2-Cyclohexyl-4-thiazolamine
  • 4-Thiazolamine, 2-cyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.