
CAS 1159816-09-7
:2-Bromo-5-(1H-pyrazol-1-yl)pyrazine
Description:
2-Bromo-5-(1H-pyrazol-1-yl)pyrazine is a heterocyclic organic compound characterized by the presence of both bromine and pyrazole functional groups. It features a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms, and a pyrazole moiety, which is a five-membered ring with two adjacent nitrogen atoms. The bromine atom is substituted at the 2-position of the pyrazine ring, while the pyrazole group is attached at the 5-position. This compound is typically used in medicinal chemistry and research due to its potential biological activity, including antimicrobial and anticancer properties. Its molecular structure contributes to its reactivity and interaction with biological targets. The presence of halogen (bromine) can enhance lipophilicity, influencing its pharmacokinetic properties. As with many heterocyclic compounds, 2-Bromo-5-(1H-pyrazol-1-yl)pyrazine may exhibit interesting electronic properties, making it a subject of study in various chemical and pharmaceutical applications.
Formula:C7H5BrN4
InChI:InChI=1S/C7H5BrN4/c8-6-4-10-7(5-9-6)12-3-1-2-11-12/h1-5H
InChI key:InChIKey=LPBOMEVIVDARLJ-UHFFFAOYSA-N
SMILES:BrC=1N=CC(=NC1)N2C=CC=N2
Synonyms:- 2-Bromo-5-(1H-pyrazol-1-yl)pyrazine
- Pyrazine, 2-bromo-5-(1H-pyrazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.