CAS 1159816-64-4: 1-(5-Bromo-2-pyridinyl)-3-pyrrolidinol

Description: 1-(5-Bromo-2-pyridinyl)-3-pyrrolidinol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a pyrrolidine moiety. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound features a hydroxyl group (-OH) attached to the pyrrolidine, which can participate in hydrogen bonding, affecting its solubility and interaction with biological targets. This compound may exhibit properties such as being a potential ligand for various receptors or enzymes, and its structural attributes suggest it could be investigated for pharmacological applications. Additionally, the presence of both nitrogen-containing rings contributes to its basicity and potential for forming salts. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as pH and temperature. Overall, 1-(5-Bromo-2-pyridinyl)-3-pyrrolidinol represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₉H₁₁BrN₂O

InChI: InChI=1S/C9H11BrN2O/c10-7-1-2-9(11-5-7)12-4-3-8(13)6-12/h1-2,5,8,13H,3-4,6H2

InChI key: InChIKey=SXRFQXQWZRXLBR-UHFFFAOYSA-N

SMILES: BrC1=CN=C(C=C1)N2CCC(O)C2

Synonyms:

• 3-Pyrrolidinol, 1-(5-bromo-2-pyridinyl)-
• 1-(5-Bromo-2-pyridinyl)-3-pyrrolidinol

1-(5-Bromopyridin-2-yl)pyrrolidin-3-ol

CAS: 1159816-64-4

• Purity: 95+%
• Molecular weight: 243.10400390625

1-(5-Bromopyridin-2-yl)pyrrolidin-3-ol

CAS: 1159816-64-4

Versatile small molecule scaffold

• Formula: C₉H₁₁BrN₂O
• Purity: Min. 95%
• Molecular weight: 243.1 g/mol