CymitQuimica logo

CAS 1159816-66-6

:

2-(3-Fluorophenyl)-4-thiazolol

Description:
2-(3-Fluorophenyl)-4-thiazolol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position relative to the thiazole moiety. This compound may exhibit interesting biological activities due to the presence of both the thiazole and fluorophenyl functionalities, which can influence its interaction with biological targets. The thiazole ring is known for its role in various pharmacological applications, including antimicrobial and anti-inflammatory properties. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability, potentially affecting the compound's pharmacokinetics. As with many organic compounds, the specific physical and chemical properties such as solubility, melting point, and reactivity would depend on the molecular structure and the environment in which the compound is studied. Overall, 2-(3-Fluorophenyl)-4-thiazolol represents a class of compounds with potential utility in medicinal chemistry and drug development.
Formula:C9H6FNOS
InChI:InChI=1S/C9H6FNOS/c10-7-3-1-2-6(4-7)9-11-8(12)5-13-9/h1-5,12H
InChI key:InChIKey=AUOKZAFCKDYLHJ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C=2SC=C(O)N2
Synonyms:
  • 2-(3-Fluorophenyl)-4-thiazolol
  • 4-Thiazolol, 2-(3-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.