CymitQuimica logo

CAS 1159816-82-6

:

2-Cyclopropyl-4-thiazolamine

Description:
2-Cyclopropyl-4-thiazolamine is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a thiazole ring. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. This compound may exhibit properties such as being a potential inhibitor or modulator in biochemical pathways, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding due to the presence of the amine group, which may influence its solubility and reactivity. Additionally, the cyclopropyl group can impart strain, potentially affecting the compound's stability and reactivity. The compound's CAS number, 1159816-82-6, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, 2-Cyclopropyl-4-thiazolamine represents a class of compounds that may have significant implications in drug discovery and development, warranting further investigation into its properties and applications.
Formula:C6H8N2S
InChI:InChI=1S/C6H8N2S/c7-5-3-9-6(8-5)4-1-2-4/h3-4H,1-2,7H2
InChI key:InChIKey=VKAAPPJCMYMWJA-UHFFFAOYSA-N
SMILES:NC=1N=C(C2CC2)SC1
Synonyms:
  • 2-Cyclopropyl-4-thiazolamine
  • 4-Thiazolamine, 2-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.