
CAS 1159816-97-3
:[2,4′-Bipyridin]-5-ol
Description:
[2,4′-Bipyridin]-5-ol, with the CAS number 1159816-97-3, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a hydroxyl (-OH) group at the 5-position of one of the pyridine rings imparts specific chemical properties, including the ability to participate in hydrogen bonding, which can influence its solubility and reactivity. This compound is typically a solid at room temperature and may exhibit moderate polarity due to the hydroxyl group. It can act as a ligand in coordination chemistry, forming complexes with various metal ions, and is of interest in fields such as organic synthesis and materials science. Additionally, the compound may exhibit biological activity, making it relevant in medicinal chemistry. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a reaction environment.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c13-9-1-2-10(12-7-9)8-3-5-11-6-4-8/h1-7,13H
InChI key:InChIKey=XBRIRQQOXQOJLD-UHFFFAOYSA-N
SMILES:OC1=CC=C(N=C1)C=2C=CN=CC2
Synonyms:- [2,4′-Bipyridin]-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.