CAS 1159817-16-9

2-Bromo-5-isopropyl-1,3-thiazole

Description:

2-Bromo-5-isopropyl-1,3-thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which consists of a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the 2-position and an isopropyl group at the 5-position of the thiazole ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, including medicinal chemistry and agrochemicals. The isopropyl group adds steric bulk, which can influence the compound's biological activity and solubility. Additionally, thiazole derivatives are known for their diverse biological activities, including antimicrobial and antifungal properties. As with many halogenated compounds, appropriate safety measures should be taken when handling 2-Bromo-5-isopropyl-1,3-thiazole due to potential toxicity and environmental impact.

Formula: C₆H₈BrNS

InChI: InChI=1S/C6H8BrNS/c1-4(2)5-3-8-6(7)9-5/h3-4H,1-2H3

SMILES: CC(C)c1cnc(Br)s1

Synonyms:

• 2-Bromo-5-isopropylthiazole
• 2-Bromo-5-(iso-propyl)thiazole

Thiazole, 2-bromo-5-(1-methylethyl)-

CAS: 1159817-16-9

Formula: C₆H₈BrNS

Purity: 98%

Color and Shape: Liquid

Molecular weight: 206.1034

Ref: IN-DA000HAH

2-Bromo-5-isopropylthiazole

CAS: 1159817-16-9

2-Bromo-5-isopropylthiazole

Purity: 97%

Molecular weight: 206.10g/mol

Ref: 54-OR480272

2-Bromo-5-isopropylthiazole

CAS: 1159817-16-9

Formula: C₆H₈BrNS

Purity: 98%

Color and Shape: No data available.

Molecular weight: 206.1

Ref: 10-F321126