CAS 1159817-25-0

2-Bromo-5-(3-pyrrolidinyl)pyridine

Description:

2-Bromo-5-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a pyrrolidine substituent at the 5-position contributes to its unique properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents due to the polar nature of the pyridine and pyrrolidine groups. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The bromine substituent can also serve as a potential site for further chemical modifications, enhancing its utility in synthetic applications. Additionally, the presence of the pyrrolidine moiety may influence its interaction with biological targets, potentially affecting its pharmacokinetic and pharmacodynamic profiles. As with many nitrogen-containing heterocycles, it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions.

Formula: C₉H₁₁BrN₂

InChI: InChI=1S/C9H11BrN2/c10-9-2-1-7(6-12-9)8-3-4-11-5-8/h1-2,6,8,11H,3-5H2

InChI key: InChIKey=NJFBSJOFMGBIPV-UHFFFAOYSA-N

SMILES: BrC=1C=CC(=CN1)C2CCNC2

Synonyms:

• 2-Bromo-5-(3-pyrrolidinyl)pyridine
• Pyridine, 2-bromo-5-(3-pyrrolidinyl)-