
CAS 1159817-99-8
:5-(3-Thienyl)-2(1H)-pyrazinone
Description:
5-(3-Thienyl)-2(1H)-pyrazinone is a heterocyclic organic compound characterized by the presence of a pyrazinone ring fused with a thienyl group. This compound features a five-membered pyrazinone ring, which contains two nitrogen atoms, and a thiophene ring, contributing to its unique chemical properties. The thienyl substituent enhances the compound's potential for various applications in organic synthesis and medicinal chemistry due to its ability to participate in π-π stacking interactions and its electron-rich nature. The presence of the pyrazinone moiety suggests potential biological activity, as pyrazinones are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure may allow for various functionalization reactions, making it a valuable intermediate in the synthesis of more complex molecules. Its solubility and stability in different solvents can vary, influencing its reactivity and application in chemical processes. Overall, 5-(3-Thienyl)-2(1H)-pyrazinone represents a versatile scaffold in the field of organic chemistry.
Formula:C8H6N2OS
InChI:InChI=1S/C8H6N2OS/c11-8-4-9-7(3-10-8)6-1-2-12-5-6/h1-5H,(H,10,11)
InChI key:InChIKey=TWUVYINKFOSTPC-UHFFFAOYSA-N
SMILES:O=C1NC=C(N=C1)C=2C=CSC2
Synonyms:- 2(1H)-Pyrazinone, 5-(3-thienyl)-
- 5-(3-Thienyl)-2(1H)-pyrazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.