
CAS 1159818-12-8
:6-Cyclopropyl-2-pyrazinamine
Description:
6-Cyclopropyl-2-pyrazinamine is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of a cyclopropyl group at the 6-position of the pyrazine ring contributes to its unique properties, including potential steric effects and reactivity. This compound is typically classified as an amine due to the presence of an amino group (-NH2) at the 2-position, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The cyclopropyl group may influence the compound's biological activity and solubility, making it of interest in medicinal chemistry and drug development. Additionally, the compound's molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in pharmaceutical research. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of study in organic and medicinal chemistry.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c8-7-4-9-3-6(10-7)5-1-2-5/h3-5H,1-2H2,(H2,8,10)
InChI key:InChIKey=UQBCQAIYCAGULC-UHFFFAOYSA-N
SMILES:NC=1N=C(C=NC1)C2CC2
Synonyms:- 6-Cyclopropyl-2-pyrazinamine
- 6-Cyclopropylpyrazin-2-amine
- 2-Pyrazinamine, 6-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.