CAS 1159818-25-3

6-Cyclopentyl-4(3H)-pyrimidinone

Description:

6-Cyclopentyl-4(3H)-pyrimidinone is a chemical compound characterized by its pyrimidinone structure, which features a six-membered aromatic ring containing nitrogen atoms. The presence of a cyclopentyl group at the 6-position contributes to its unique properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could interact with various biological targets, possibly serving as a lead compound for further modifications. The compound's CAS number, 1159818-25-3, allows for precise identification in chemical databases and literature. As with many pyrimidinones, it may participate in hydrogen bonding due to the carbonyl and nitrogen functionalities, which can affect its physical properties such as melting point and boiling point. Overall, 6-Cyclopentyl-4(3H)-pyrimidinone represents a class of compounds that may have significant applications in pharmaceuticals and biochemistry, warranting further investigation into its properties and potential uses.

Formula: C₉H₁₂N₂O

InChI: InChI=1S/C9H12N2O/c12-9-5-8(10-6-11-9)7-3-1-2-4-7/h5-7H,1-4H2,(H,10,11,12)

InChI key: InChIKey=CCBGCVWONHQIHN-UHFFFAOYSA-N

SMILES: O=C1C=C(NC=N1)C2CCCC2

Synonyms:

• 6-Cyclopentyl-4(3H)-pyrimidinone
• 4(3H)-Pyrimidinone, 6-cyclopentyl-