CAS 1159818-46-8

5-(2-Methylphenyl)-2(1H)-pyrazinone

Description:

5-(2-Methylphenyl)-2(1H)-pyrazinone, identified by its CAS number 1159818-46-8, is an organic compound characterized by its pyrazinone core, which features a five-membered ring containing two nitrogen atoms. This compound exhibits a substitution pattern where a 2-methylphenyl group is attached to the pyrazinone structure, influencing its chemical properties and reactivity. Typically, compounds of this nature may display biological activity, making them of interest in medicinal chemistry and drug development. The presence of the methyl group on the phenyl ring can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the pyrazinone moiety may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular structure and the interactions between its functional groups. Overall, 5-(2-Methylphenyl)-2(1H)-pyrazinone represents a class of compounds that can be explored for various applications in pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1S/C11H10N2O/c1-8-4-2-3-5-9(8)10-6-13-11(14)7-12-10/h2-7H,1H3,(H,13,14)

InChI key: InChIKey=GOYFMMYRKOXDSZ-UHFFFAOYSA-N

SMILES: CC1=C(C2=CNC(=O)C=N2)C=CC=C1

Synonyms:

• 2(1H)-Pyrazinone, 5-(2-methylphenyl)-
• 5-(2-Methylphenyl)-2(1H)-pyrazinone