CymitQuimica logo

CAS 1159818-72-0

:

6-(2-Pyridinyl)-4-pyrimidinamine

Description:
6-(2-Pyridinyl)-4-pyrimidinamine, identified by its CAS number 1159818-72-0, is a chemical compound characterized by its heterocyclic structure, which includes both pyridine and pyrimidine rings. This compound typically exhibits properties associated with aromatic amines, such as potential basicity due to the presence of nitrogen atoms in the rings. It may demonstrate solubility in polar solvents, influenced by its functional groups, and could engage in hydrogen bonding due to the amino group. The presence of the pyridine moiety often contributes to its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features may allow for interactions with various biological targets, potentially leading to applications in treating diseases. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen atoms and the overall molecular geometry. As with many heterocyclic compounds, it may also exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy.
Formula:C9H8N4
InChI:InChI=1S/C9H8N4/c10-9-5-8(12-6-13-9)7-3-1-2-4-11-7/h1-6H,(H2,10,12,13)
InChI key:InChIKey=CLXBBUFTURCCRI-UHFFFAOYSA-N
SMILES:NC1=CC(=NC=N1)C2=CC=CC=N2
Synonyms:
  • 4-Pyrimidinamine, 6-(2-pyridinyl)-
  • 6-(2-Pyridinyl)-4-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.