CymitQuimica logo

CAS 1159818-73-1

:

2-Cyclopropyl-6-(2-pyridinyl)-4(3H)-pyrimidinone

Description:
2-Cyclopropyl-6-(2-pyridinyl)-4(3H)-pyrimidinone is a chemical compound characterized by its unique bicyclic structure, which includes a pyrimidinone core and a cyclopropyl group. This compound features a pyridine ring, contributing to its potential biological activity and interaction with various biological targets. The presence of the cyclopropyl group can influence the compound's conformational flexibility and reactivity, making it of interest in medicinal chemistry. The molecular structure suggests that it may exhibit properties such as lipophilicity and the ability to form hydrogen bonds, which are important for its interaction with biological macromolecules. Additionally, the compound may possess pharmacological properties, potentially acting as an inhibitor or modulator in various biochemical pathways. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H11N3O
InChI:InChI=1S/C12H11N3O/c16-11-7-10(9-3-1-2-6-13-9)14-12(15-11)8-4-5-8/h1-3,6-8H,4-5H2,(H,14,15,16)
InChI key:InChIKey=VNJXOAPYTZDXHP-UHFFFAOYSA-N
SMILES:O=C1N=C(C2CC2)NC(=C1)C3=CC=CC=N3
Synonyms:
  • 4(3H)-Pyrimidinone, 2-cyclopropyl-6-(2-pyridinyl)-
  • 2-Cyclopropyl-6-(2-pyridinyl)-4(3H)-pyrimidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.