CAS 1159819-10-9

2-Cyclopentyl-5-thiazolamine

Description:

2-Cyclopentyl-5-thiazolamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a cyclopentyl group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. This compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of amine and thiazole functionalities. The cyclopentyl group can influence the compound's lipophilicity and steric properties, which may affect its interaction with biological targets. Additionally, the presence of the amine group suggests that it could participate in hydrogen bonding, impacting its solubility and reactivity. While specific data on its physical and chemical properties may vary, compounds of this nature are often studied for their potential applications in medicinal chemistry and material science. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₈H₁₂N₂S

InChI: InChI=1S/C8H12N2S/c9-7-5-10-8(11-7)6-3-1-2-4-6/h5-6H,1-4,9H2

InChI key: InChIKey=SIPZALTZOZTHLA-UHFFFAOYSA-N

SMILES: NC=1SC(=NC1)C2CCCC2

Synonyms:

• 5-Thiazolamine, 2-cyclopentyl-
• 2-Cyclopentyl-5-thiazolamine