CAS 1159819-59-6

6-[3-(Trifluoromethyl)phenyl]-2-pyridinamine

Description:

6-[3-(Trifluoromethyl)phenyl]-2-pyridinamine, identified by its CAS number 1159819-59-6, is an organic compound characterized by its unique molecular structure, which includes a pyridine ring substituted with an amino group and a phenyl group that carries a trifluoromethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the amino group may participate in hydrogen bonding, affecting the compound's overall chemical behavior. Due to these characteristics, compounds like this one are of interest in medicinal chemistry and materials science, where they may serve as intermediates or active pharmaceutical ingredients. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.

Formula: C₁₂H₉F₃N₂

InChI: InChI=1S/C12H9F3N2/c13-12(14,15)9-4-1-3-8(7-9)10-5-2-6-11(16)17-10/h1-7H,(H2,16,17)

InChI key: InChIKey=LMWLCIVNWAOBSZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1)C=2N=C(N)C=CC2

Synonyms:

• 2-Pyridinamine, 6-[3-(trifluoromethyl)phenyl]-
• 6-[3-(Trifluoromethyl)phenyl]-2-pyridinamine